C15H21F3O3S — CID 134962127
[(5R,6R)-2,6-dimethyl-5-prop-1-en-2-yl-6-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 134962127) has the molecular formula C15H21F3O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is [(5R,6R)-2,6-dimethyl-5-prop-1-en-2-yl-6-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(5R,6R)-2,6-dimethyl-5-prop-1-en-2-yl-6-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134962127 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(5R,6R)-2,6-dimethyl-5-prop-1-en-2-yl-6-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | C=CC[C@@]1(C)C(OS(=O)(=O)C(F)(F)F)=C(C)CC[C@@H]1C(=C)C |
| InChI | InChI=1S/C15H21F3O3S/c1-6-9-14(5)12(10(2)3)8-7-11(4)13(14)21-22(19,20)15(16,17)18/h6,12H,1-2,7-9H2,3-5H3/t12-,14-/m1/s1 |
| InChIKey | KRRDEMHCRYUKIP-TZMCWYRMSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|