C24H36O7 — CID 134962153
methyl (1R,4R,5S,6S,7R,10S,11R)-5-(diethoxymethyl)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-4-carboxylate (PubChem CID 134962153) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is methyl (1R,4R,5S,6S,7R,10S,11R)-5-(diethoxymethyl)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-4-carboxylate.
| Compound Name | methyl (1R,4R,5S,6S,7R,10S,11R)-5-(diethoxymethyl)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-4-carboxylate |
|---|---|
| PubChem CID | 134962153 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | methyl (1R,4R,5S,6S,7R,10S,11R)-5-(diethoxymethyl)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-4-carboxylate |
| SMILES | C/C=C/[C@H]1[C@H](C(OCC)OCC)[C@]2(C(=O)OC)C(=O)O[C@H]3[C@@H]2[C@]1(C)C(=O)C[C@H]3C(C)C |
| InChI | InChI=1S/C24H36O7/c1-8-11-15-17(20(29-9-2)30-10-3)24(21(26)28-7)19-18(31-22(24)27)14(13(4)5)12-16(25)23(15,19)6/h8,11,13-15,17-20H,9-10,12H2,1-7H3/b11-8+/t14-,15-,17+,18+,19+,23-,24-/m0/s1 |
| InChIKey | ZNIZSDJHSLUVTM-NKSSUJIDSA-N |
| XLogP | 3.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|