About (3R)-3-cyclopentyl-N,N-dimethylhexanamide
(3R)-3-cyclopentyl-N,N-dimethylhexanamide (PubChem CID 134962213) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (3R)-3-cyclopentyl-N,N-dimethylhexanamide.
Molecular Properties
| Compound Name | (3R)-3-cyclopentyl-N,N-dimethylhexanamide |
| PubChem CID | 134962213 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3R)-3-cyclopentyl-N,N-dimethylhexanamide |
| SMILES | CCC[C@H](CC(=O)N(C)C)C1CCCC1 |
| InChI | InChI=1S/C13H25NO/c1-4-7-12(10-13(15)14(2)3)11-8-5-6-9-11/h11-12H,4-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | GMUCAOMGHSKWHG-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-cyclopentyl-N,N-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-cyclopentyl-N,N-dimethylhexanamide?
The IUPAC name of (3R)-3-cyclopentyl-N,N-dimethylhexanamide (CID 134962213) is (3R)-3-cyclopentyl-N,N-dimethylhexanamide.
What is the SMILES notation for (3R)-3-cyclopentyl-N,N-dimethylhexanamide?
The canonical SMILES for (3R)-3-cyclopentyl-N,N-dimethylhexanamide is CCC[C@H](CC(=O)N(C)C)C1CCCC1.
What is the InChIKey of (3R)-3-cyclopentyl-N,N-dimethylhexanamide?
The InChIKey is GMUCAOMGHSKWHG-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H25NO/c1-4-7-12(10-13(15)14(2)3)11-8-5-6-9-11/h11-12H,4-10H2,1-3H3/t12-/m1/s1.
What are the key properties of (3R)-3-cyclopentyl-N,N-dimethylhexanamide?
(3R)-3-cyclopentyl-N,N-dimethylhexanamide has a molecular weight of 211.35 g/mol, XLogP of 3.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-cyclopentyl-N,N-dimethylhexanamide is sourced from PubChem (CID 134962213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).