About 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene
3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene (PubChem CID 134962274) has the molecular formula C12H5ClF4
and a molecular weight of 260.62 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene |
| PubChem CID | 134962274 |
| Molecular Formula | C12H5ClF4 |
| Molecular Weight | 260.62 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(F)c(F)c(-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C12H5ClF4/c13-7-4-2-1-3-6(7)10-11(16)8(14)5-9(15)12(10)17/h1-5H |
| InChIKey | OZQCMQFXGANYLT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene?
The IUPAC name of 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene (CID 134962274) is 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene.
What is the SMILES notation for 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene?
The canonical SMILES for 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene is Fc1cc(F)c(F)c(-c2ccccc2Cl)c1F.
What is the InChIKey of 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene?
The InChIKey is OZQCMQFXGANYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5ClF4/c13-7-4-2-1-3-6(7)10-11(16)8(14)5-9(15)12(10)17/h1-5H.
What are the key properties of 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene?
3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene has a molecular weight of 260.62 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-1,2,4,5-tetrafluorobenzene is sourced from PubChem (CID 134962274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).