About cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid
cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 134962375) has the molecular formula C14H22O6
and a molecular weight of 286.32 g/mol. Its IUPAC name is cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 134962375 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | C/C=C/[C@H]1[C@H](C(OCC)OCC)C1(C(=O)O)C(=O)OC |
| InChI | InChI=1S/C14H22O6/c1-5-8-9-10(11(19-6-2)20-7-3)14(9,12(15)16)13(17)18-4/h5,8-11H,6-7H2,1-4H3,(H,15,16)/b8-5+/t9-,10+,14?/m0/s1 |
| InChIKey | KXFUBTZGZNVERA-OSQIDADMSA-N |
| XLogP | 1.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid (CID 134962375) is cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid is C/C=C/[C@H]1[C@H](C(OCC)OCC)C1(C(=O)O)C(=O)OC.
What is the InChIKey of cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid?
The InChIKey is KXFUBTZGZNVERA-OSQIDADMSA-N. The full InChI is InChI=1S/C14H22O6/c1-5-8-9-10(11(19-6-2)20-7-3)14(9,12(15)16)13(17)18-4/h5,8-11H,6-7H2,1-4H3,(H,15,16)/b8-5+/t9-,10+,14?/m0/s1.
What are the key properties of cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid?
cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid has a molecular weight of 286.32 g/mol, XLogP of 1.45, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3S)-2-(diethoxymethyl)-1-methoxycarbonyl-3-[(E)-prop-1-enyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 134962375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).