C31H48O6Si2 — CID 134962459
(3S,3aR,4R,6aR,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-3,9-dimethyl-6-methylidene-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one (PubChem CID 134962459) has the molecular formula C31H48O6Si2 and a molecular weight of 572.89 g/mol. Its IUPAC name is (3S,3aR,4R,6aR,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-3,9-dimethyl-6-methylidene-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aR,4R,6aR,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-3,9-dimethyl-6-methylidene-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 134962459 |
| Molecular Formula | C31H48O6Si2 |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (3S,3aR,4R,6aR,8R,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-3,9-dimethyl-6-methylidene-4-phenylmethoxy-3-trimethylsilyloxy-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1C[C@@H](OCc2ccccc2)[C@@]2(O)[C@@H](OC(=O)[C@@]2(C)O[Si](C)(C)C)C2=C(C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C31H48O6Si2/c1-20-17-25(34-19-22-15-13-12-14-16-22)31(33)27(35-28(32)30(31,6)37-38(7,8)9)26-21(2)24(18-23(20)26)36-39(10,11)29(3,4)5/h12-16,23-25,27,33H,1,17-19H2,2-11H3/t23-,24-,25-,27+,30-,31-/m1/s1 |
| InChIKey | LWAKTOXEBDIIJV-HQQCSXKQSA-N |
| XLogP | 6.53 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|