About (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one
(10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one (PubChem CID 134962677) has the molecular formula C24H17NO
and a molecular weight of 335.41 g/mol. Its IUPAC name is (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one.
Molecular Properties
| Compound Name | (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one |
| PubChem CID | 134962677 |
| Molecular Formula | C24H17NO |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one |
| SMILES | C[C@@]12c3ccccc3C(=O)N1c1ccccc1[C@@H]2C#Cc1ccccc1 |
| InChI | InChI=1S/C24H17NO/c1-24-20-13-7-5-12-19(20)23(26)25(24)22-14-8-6-11-18(22)21(24)16-15-17-9-3-2-4-10-17/h2-14,21H,1H3/t21-,24-/m0/s1 |
| InChIKey | QMMJTPKOOHVYRP-URXFXBBRSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one?
The IUPAC name of (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one (CID 134962677) is (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one.
What is the SMILES notation for (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one?
The canonical SMILES for (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one is C[C@@]12c3ccccc3C(=O)N1c1ccccc1[C@@H]2C#Cc1ccccc1.
What is the InChIKey of (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one?
The InChIKey is QMMJTPKOOHVYRP-URXFXBBRSA-N. The full InChI is InChI=1S/C24H17NO/c1-24-20-13-7-5-12-19(20)23(26)25(24)22-14-8-6-11-18(22)21(24)16-15-17-9-3-2-4-10-17/h2-14,21H,1H3/t21-,24-/m0/s1.
What are the key properties of (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one?
(10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one has a molecular weight of 335.41 g/mol, XLogP of 4.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10bR,11S)-10b-methyl-11-(2-phenylethynyl)-11H-isoindolo[2,1-a]indol-6-one is sourced from PubChem (CID 134962677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).