C29H40N2 — CID 134962713
1,3-bis[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide (PubChem CID 134962713) has the molecular formula C29H40N2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 134962713 |
| Molecular Formula | C29H40N2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-4,5-dimethyl-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1c(C)[n+](-c2c(C(C)C)cccc2C(C)C)[c-]n1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H40N2/c1-18(2)24-13-11-14-25(19(3)4)28(24)30-17-31(23(10)22(30)9)29-26(20(5)6)15-12-16-27(29)21(7)8/h11-16,18-21H,1-10H3 |
| InChIKey | QQXCIKBWNKVJGR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|