About 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile
3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile (PubChem CID 134962823) has the molecular formula C22H18N2O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile |
| PubChem CID | 134962823 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile |
| SMILES | COc1cc(OC)c2c(c1)-c1ccccc1N[C@H]2c1cccc(C#N)c1 |
| InChI | InChI=1S/C22H18N2O2/c1-25-16-11-18-17-8-3-4-9-19(17)24-22(21(18)20(12-16)26-2)15-7-5-6-14(10-15)13-23/h3-12,22,24H,1-2H3/t22-/m0/s1 |
| InChIKey | WEOFXSLYCBGFCN-QFIPXVFZSA-N |
| XLogP | 4.76 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile?
The IUPAC name of 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile (CID 134962823) is 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile.
What is the SMILES notation for 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile?
The canonical SMILES for 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile is COc1cc(OC)c2c(c1)-c1ccccc1N[C@H]2c1cccc(C#N)c1.
What is the InChIKey of 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile?
The InChIKey is WEOFXSLYCBGFCN-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H18N2O2/c1-25-16-11-18-17-8-3-4-9-19(17)24-22(21(18)20(12-16)26-2)15-7-5-6-14(10-15)13-23/h3-12,22,24H,1-2H3/t22-/m0/s1.
What are the key properties of 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile?
3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile has a molecular weight of 342.40 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6S)-7,9-dimethoxy-5,6-dihydrophenanthridin-6-yl]benzonitrile is sourced from PubChem (CID 134962823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).