C22H17ClN2O4 — CID 134962828
(5R,6R)-5-(4-chlorophenyl)-6-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylcyclohex-2-en-1-one (PubChem CID 134962828) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is (5R,6R)-5-(4-chlorophenyl)-6-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-5-(4-chlorophenyl)-6-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134962828 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (5R,6R)-5-(4-chlorophenyl)-6-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylcyclohex-2-en-1-one |
| SMILES | Cc1noc([C@@H]2C(=O)C=C(c3ccccc3)C[C@H]2c2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17ClN2O4/c1-13-21(25(27)28)22(29-24-13)20-18(15-7-9-17(23)10-8-15)11-16(12-19(20)26)14-5-3-2-4-6-14/h2-10,12,18,20H,11H2,1H3/t18-,20-/m0/s1 |
| InChIKey | VOBYZSMLKITCQJ-ICSRJNTNSA-N |
| XLogP | 5.47 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|