C20H32O5 — CID 134962888
(3aS,4S,4aR,5S,8S,8aS,9R,9aS)-8-ethenyl-4-(methoxymethoxy)-2,2,4a,6,9-pentamethyl-4,5,8,8a,9,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxol-5-ol (PubChem CID 134962888) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3aS,4S,4aR,5S,8S,8aS,9R,9aS)-8-ethenyl-4-(methoxymethoxy)-2,2,4a,6,9-pentamethyl-4,5,8,8a,9,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxol-5-ol.
| Compound Name | (3aS,4S,4aR,5S,8S,8aS,9R,9aS)-8-ethenyl-4-(methoxymethoxy)-2,2,4a,6,9-pentamethyl-4,5,8,8a,9,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxol-5-ol |
|---|---|
| PubChem CID | 134962888 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3aS,4S,4aR,5S,8S,8aS,9R,9aS)-8-ethenyl-4-(methoxymethoxy)-2,2,4a,6,9-pentamethyl-4,5,8,8a,9,9a-hexahydro-3aH-naphtho[6,7-d][1,3]dioxol-5-ol |
| SMILES | C=C[C@H]1C=C(C)[C@H](O)[C@@]2(C)[C@@H]1[C@@H](C)[C@@H]1OC(C)(C)O[C@@H]1[C@H]2OCOC |
| InChI | InChI=1S/C20H32O5/c1-8-13-9-11(2)17(21)20(6)14(13)12(3)15-16(18(20)23-10-22-7)25-19(4,5)24-15/h8-9,12-18,21H,1,10H2,2-7H3/t12-,13+,14-,15+,16+,17+,18-,20-/m1/s1 |
| InChIKey | VONJIXXODFUBRN-RALBGLFJSA-N |
| XLogP | 2.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|