C11H19BO2 — CID 134962917
(5R,6S)-6-cyclohexyl-2-hydroxy-5-methyl-5,6-dihydrooxaborinine (PubChem CID 134962917) has the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. Its IUPAC name is (5R,6S)-6-cyclohexyl-2-hydroxy-5-methyl-5,6-dihydrooxaborinine.
| Compound Name | (5R,6S)-6-cyclohexyl-2-hydroxy-5-methyl-5,6-dihydrooxaborinine |
|---|---|
| PubChem CID | 134962917 |
| Molecular Formula | C11H19BO2 |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (5R,6S)-6-cyclohexyl-2-hydroxy-5-methyl-5,6-dihydrooxaborinine |
| SMILES | C[C@@H]1C=CB(O)O[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C11H19BO2/c1-9-7-8-12(13)14-11(9)10-5-3-2-4-6-10/h7-11,13H,2-6H2,1H3/t9-,11-/m1/s1 |
| InChIKey | ZSYPWKBGKTYBBU-MWLCHTKSSA-N |
| XLogP | 2.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|