C14H11N5 — CID 134962975
N,6-diphenyl-1,2,4,5-tetrazin-3-amine (PubChem CID 134962975) has the molecular formula C14H11N5 and a molecular weight of 249.28 g/mol. Its IUPAC name is N,6-diphenyl-1,2,4,5-tetrazin-3-amine.
| Compound Name | N,6-diphenyl-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 134962975 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N,6-diphenyl-1,2,4,5-tetrazin-3-amine |
| SMILES | c1ccc(Nc2nnc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C14H11N5/c1-3-7-11(8-4-1)13-16-18-14(19-17-13)15-12-9-5-2-6-10-12/h1-10H,(H,15,18,19) |
| InChIKey | ZFPNJYGMNKZQTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |