About 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine
4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine (PubChem CID 134963042) has the molecular formula C23H21ClN2O2
and a molecular weight of 392.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine |
| PubChem CID | 134963042 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine |
| SMILES | COc1ccc(/N=C2\CC(c3ccc(Cl)cc3)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-27-20-11-7-18(8-12-20)25-23-15-22(16-3-5-17(24)6-4-16)26(23)19-9-13-21(28-2)14-10-19/h3-14,22H,15H2,1-2H3/b25-23+ |
| InChIKey | XOYDBIUHRUTSDO-WJTDDFOZSA-N |
| XLogP | 6.04 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine?
The IUPAC name of 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine (CID 134963042) is 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine.
What is the SMILES notation for 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine?
The canonical SMILES for 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine is COc1ccc(/N=C2\CC(c3ccc(Cl)cc3)N2c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine?
The InChIKey is XOYDBIUHRUTSDO-WJTDDFOZSA-N. The full InChI is InChI=1S/C23H21ClN2O2/c1-27-20-11-7-18(8-12-20)25-23-15-22(16-3-5-17(24)6-4-16)26(23)19-9-13-21(28-2)14-10-19/h3-14,22H,15H2,1-2H3/b25-23+.
What are the key properties of 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine?
4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine has a molecular weight of 392.89 g/mol, XLogP of 6.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-N,1-bis(4-methoxyphenyl)azetidin-2-imine is sourced from PubChem (CID 134963042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).