C19H28O3 — CID 134963084
(1S,5R,8R,10R,12R,14R)-4,8-dihydroxy-7,11,11,14-tetramethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one (PubChem CID 134963084) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,5R,8R,10R,12R,14R)-4,8-dihydroxy-7,11,11,14-tetramethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one.
| Compound Name | (1S,5R,8R,10R,12R,14R)-4,8-dihydroxy-7,11,11,14-tetramethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
|---|---|
| PubChem CID | 134963084 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,5R,8R,10R,12R,14R)-4,8-dihydroxy-7,11,11,14-tetramethyltetracyclo[7.6.0.01,5.010,12]pentadec-6-en-15-one |
| SMILES | CC1=C[C@H]2C(O)CC[C@]23C(=O)[C@H](C)C[C@@H]2[C@H](C3C1O)C2(C)C |
| InChI | InChI=1S/C19H28O3/c1-9-7-11-13(20)5-6-19(11)15(16(9)21)14-12(18(14,3)4)8-10(2)17(19)22/h7,10-16,20-21H,5-6,8H2,1-4H3/t10-,11+,12-,13?,14-,15?,16?,19+/m1/s1 |
| InChIKey | CJGHCXPXGIQQMW-ZWHUAHHJSA-N |
| XLogP | 2.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|