C16H18ClN5O3 — CID 134963108
4-chloro-N-[(1R,2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)cyclopentyl]pyridine-2-carboxamide (PubChem CID 134963108) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)cyclopentyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)cyclopentyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134963108 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)cyclopentyl]pyridine-2-carboxamide |
| SMILES | Cc1nn([C@@H]2CCC[C@H]2NC(=O)c2cc(Cl)ccn2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18ClN5O3/c1-9-15(22(24)25)10(2)21(20-9)14-5-3-4-12(14)19-16(23)13-8-11(17)6-7-18-13/h6-8,12,14H,3-5H2,1-2H3,(H,19,23)/t12-,14-/m1/s1 |
| InChIKey | XTOITTBMTMBZGG-TZMCWYRMSA-N |
| XLogP | 2.98 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|