C20H22O3 — CID 134963199
(3R)-3-(3-methoxyphenyl)-3-(4-methoxyphenyl)cyclohexan-1-one (PubChem CID 134963199) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (3R)-3-(3-methoxyphenyl)-3-(4-methoxyphenyl)cyclohexan-1-one.
| Compound Name | (3R)-3-(3-methoxyphenyl)-3-(4-methoxyphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134963199 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (3R)-3-(3-methoxyphenyl)-3-(4-methoxyphenyl)cyclohexan-1-one |
| SMILES | COc1ccc([C@@]2(c3cccc(OC)c3)CCCC(=O)C2)cc1 |
| InChI | InChI=1S/C20H22O3/c1-22-18-10-8-15(9-11-18)20(12-4-6-17(21)14-20)16-5-3-7-19(13-16)23-2/h3,5,7-11,13H,4,6,12,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | QTHRXYAMBNEZCW-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |