About tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc
tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc (PubChem CID 134963293) has the molecular formula C9H16NO2Zn-
and a molecular weight of 235.62 g/mol. Its IUPAC name is tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc.
Molecular Properties
| Compound Name | tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc |
| PubChem CID | 134963293 |
| Molecular Formula | C9H16NO2Zn- |
| Molecular Weight | 235.62 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc |
| SMILES | CC(C)(C)OC(=O)N1[CH-]CCC1.[Zn] |
| InChI | InChI=1S/C9H16NO2.Zn/c1-9(2,3)12-8(11)10-6-4-5-7-10;/h6H,4-5,7H2,1-3H3;/q-1; |
| InChIKey | IIQHIPDEHJLXAS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc?
The IUPAC name of tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc (CID 134963293) is tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc.
What is the SMILES notation for tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc?
The canonical SMILES for tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc is CC(C)(C)OC(=O)N1[CH-]CCC1.[Zn].
What is the InChIKey of tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc?
The InChIKey is IIQHIPDEHJLXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO2.Zn/c1-9(2,3)12-8(11)10-6-4-5-7-10;/h6H,4-5,7H2,1-3H3;/q-1;.
What are the key properties of tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc?
tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc has a molecular weight of 235.62 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidin-5-ide-1-carboxylate;zinc is sourced from PubChem (CID 134963293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).