C21H31NO2 — CID 134963295
tert-butyl (2S)-2-(4-phenylcyclohexyl)pyrrolidine-1-carboxylate (PubChem CID 134963295) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-phenylcyclohexyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(4-phenylcyclohexyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134963295 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | tert-butyl (2S)-2-(4-phenylcyclohexyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO2/c1-21(2,3)24-20(23)22-15-7-10-19(22)18-13-11-17(12-14-18)16-8-5-4-6-9-16/h4-6,8-9,17-19H,7,10-15H2,1-3H3/t17?,18?,19-/m0/s1 |
| InChIKey | GKACVSGINDFRAK-ACBHZAAOSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |