About tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate
tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate (PubChem CID 134963297) has the molecular formula C17H31NO2
and a molecular weight of 281.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate |
| PubChem CID | 134963297 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1CC([C@@H]2CCCN2C(=O)OC(C)(C)C)C[C@H](C)C1 |
| InChI | InChI=1S/C17H31NO2/c1-12-9-13(2)11-14(10-12)15-7-6-8-18(15)16(19)20-17(3,4)5/h12-15H,6-11H2,1-5H3/t12-,13+,14?,15-/m0/s1 |
| InChIKey | VATCAYCEMMMRBQ-IXXDHKBRSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate (CID 134963297) is tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate is C[C@@H]1CC([C@@H]2CCCN2C(=O)OC(C)(C)C)C[C@H](C)C1.
What is the InChIKey of tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate?
The InChIKey is VATCAYCEMMMRBQ-IXXDHKBRSA-N. The full InChI is InChI=1S/C17H31NO2/c1-12-9-13(2)11-14(10-12)15-7-6-8-18(15)16(19)20-17(3,4)5/h12-15H,6-11H2,1-5H3/t12-,13+,14?,15-/m0/s1.
What are the key properties of tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate has a molecular weight of 281.44 g/mol, XLogP of 4.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(3R,5S)-3,5-dimethylcyclohexyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 134963297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).