C12H11F3N2O2 — CID 134963333
1-[1-(2-hydroxyethyl)-2-(trifluoromethyl)benzimidazol-4-yl]ethanone (PubChem CID 134963333) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)-2-(trifluoromethyl)benzimidazol-4-yl]ethanone.
| Compound Name | 1-[1-(2-hydroxyethyl)-2-(trifluoromethyl)benzimidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 134963333 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)-2-(trifluoromethyl)benzimidazol-4-yl]ethanone |
| SMILES | CC(=O)c1cccc2c1nc(C(F)(F)F)n2CCO |
| InChI | InChI=1S/C12H11F3N2O2/c1-7(19)8-3-2-4-9-10(8)16-11(12(13,14)15)17(9)5-6-18/h2-4,18H,5-6H2,1H3 |
| InChIKey | BHLPFBPPPGTWLP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |