C12H26O3 — CID 134963377
2,3,4,5,6-pentamethylheptane-2,3,5-triol (PubChem CID 134963377) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylheptane-2,3,5-triol.
| Compound Name | 2,3,4,5,6-pentamethylheptane-2,3,5-triol |
|---|---|
| PubChem CID | 134963377 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 2,3,4,5,6-pentamethylheptane-2,3,5-triol |
| SMILES | CC(C)C(C)(O)C(C)C(C)(O)C(C)(C)O |
| InChI | InChI=1S/C12H26O3/c1-8(2)11(6,14)9(3)12(7,15)10(4,5)13/h8-9,13-15H,1-7H3 |
| InChIKey | HQAHCKDMLNETNU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |