C10H12F3N — CID 134963478
2-(trifluoromethyl)-1,2,5,6,7,8-hexahydroquinoline (PubChem CID 134963478) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,2,5,6,7,8-hexahydroquinoline.
| Compound Name | 2-(trifluoromethyl)-1,2,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 134963478 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(trifluoromethyl)-1,2,5,6,7,8-hexahydroquinoline |
| SMILES | FC(F)(F)C1C=CC2=C(CCCC2)N1 |
| InChI | InChI=1S/C10H12F3N/c11-10(12,13)9-6-5-7-3-1-2-4-8(7)14-9/h5-6,9,14H,1-4H2 |
| InChIKey | JUEXWLZAIAUGDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |