About (7Z)-2,8-dibromoocta-1,7-dien-4-ol
(7Z)-2,8-dibromoocta-1,7-dien-4-ol (PubChem CID 134963518) has the molecular formula C8H12Br2O
and a molecular weight of 283.99 g/mol. Its IUPAC name is (7Z)-2,8-dibromoocta-1,7-dien-4-ol.
Molecular Properties
| Compound Name | (7Z)-2,8-dibromoocta-1,7-dien-4-ol |
| PubChem CID | 134963518 |
| Molecular Formula | C8H12Br2O |
| Molecular Weight | 283.99 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | (7Z)-2,8-dibromoocta-1,7-dien-4-ol |
| SMILES | C=C(Br)CC(O)CC/C=C\Br |
| InChI | InChI=1S/C8H12Br2O/c1-7(10)6-8(11)4-2-3-5-9/h3,5,8,11H,1-2,4,6H2/b5-3- |
| InChIKey | CCKJZBNEPQBUKW-HYXAFXHYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.99 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7Z)-2,8-dibromoocta-1,7-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-2,8-dibromoocta-1,7-dien-4-ol?
The IUPAC name of (7Z)-2,8-dibromoocta-1,7-dien-4-ol (CID 134963518) is (7Z)-2,8-dibromoocta-1,7-dien-4-ol.
What is the SMILES notation for (7Z)-2,8-dibromoocta-1,7-dien-4-ol?
The canonical SMILES for (7Z)-2,8-dibromoocta-1,7-dien-4-ol is C=C(Br)CC(O)CC/C=C\Br.
What is the InChIKey of (7Z)-2,8-dibromoocta-1,7-dien-4-ol?
The InChIKey is CCKJZBNEPQBUKW-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H12Br2O/c1-7(10)6-8(11)4-2-3-5-9/h3,5,8,11H,1-2,4,6H2/b5-3-.
What are the key properties of (7Z)-2,8-dibromoocta-1,7-dien-4-ol?
(7Z)-2,8-dibromoocta-1,7-dien-4-ol has a molecular weight of 283.99 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-2,8-dibromoocta-1,7-dien-4-ol is sourced from PubChem (CID 134963518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).