About hepta-1,6-dien-3-ylcyclohexane
hepta-1,6-dien-3-ylcyclohexane (PubChem CID 134963538) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is hepta-1,6-dien-3-ylcyclohexane.
Molecular Properties
| Compound Name | hepta-1,6-dien-3-ylcyclohexane |
| PubChem CID | 134963538 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | hepta-1,6-dien-3-ylcyclohexane |
| SMILES | C=CCCC(C=C)C1CCCCC1 |
| InChI | InChI=1S/C13H22/c1-3-5-9-12(4-2)13-10-7-6-8-11-13/h3-4,12-13H,1-2,5-11H2 |
| InChIKey | YWXZNIDLHTTZRB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,6-dien-3-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,6-dien-3-ylcyclohexane?
The IUPAC name of hepta-1,6-dien-3-ylcyclohexane (CID 134963538) is hepta-1,6-dien-3-ylcyclohexane.
What is the SMILES notation for hepta-1,6-dien-3-ylcyclohexane?
The canonical SMILES for hepta-1,6-dien-3-ylcyclohexane is C=CCCC(C=C)C1CCCCC1.
What is the InChIKey of hepta-1,6-dien-3-ylcyclohexane?
The InChIKey is YWXZNIDLHTTZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-3-5-9-12(4-2)13-10-7-6-8-11-13/h3-4,12-13H,1-2,5-11H2.
What are the key properties of hepta-1,6-dien-3-ylcyclohexane?
hepta-1,6-dien-3-ylcyclohexane has a molecular weight of 178.32 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-3-ylcyclohexane is sourced from PubChem (CID 134963538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).