C14H16F3NO — CID 134963662
N-[(2R)-but-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide (PubChem CID 134963662) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[(2R)-but-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide.
| Compound Name | N-[(2R)-but-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 134963662 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(2R)-but-3-en-2-yl]-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
| SMILES | C=C[C@@H](C)N(CCc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO/c1-3-11(2)18(13(19)14(15,16)17)10-9-12-7-5-4-6-8-12/h3-8,11H,1,9-10H2,2H3/t11-/m1/s1 |
| InChIKey | DUXZTRVALWJJIC-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|