About 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one
4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one (PubChem CID 134963804) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one.
Molecular Properties
| Compound Name | 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one |
| PubChem CID | 134963804 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one |
| SMILES | C=C1CC23CCC(O)CC2C(=O)CC1C3 |
| InChI | InChI=1S/C13H18O2/c1-8-6-13-3-2-10(14)5-11(13)12(15)4-9(8)7-13/h9-11,14H,1-7H2 |
| InChIKey | AAZLDTYDNKRFEP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one?
The IUPAC name of 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one (CID 134963804) is 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one.
What is the SMILES notation for 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one?
The canonical SMILES for 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one is C=C1CC23CCC(O)CC2C(=O)CC1C3.
What is the InChIKey of 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one?
The InChIKey is AAZLDTYDNKRFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-8-6-13-3-2-10(14)5-11(13)12(15)4-9(8)7-13/h9-11,14H,1-7H2.
What are the key properties of 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one?
4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one has a molecular weight of 206.28 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-10-methylidenetricyclo[7.2.1.01,6]dodecan-7-one is sourced from PubChem (CID 134963804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).