C11H23NO3S — CID 134963859
1-(1-tert-butylsulfonylaziridin-2-yl)-2,2-dimethylpropan-1-ol (PubChem CID 134963859) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(1-tert-butylsulfonylaziridin-2-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(1-tert-butylsulfonylaziridin-2-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 134963859 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(1-tert-butylsulfonylaziridin-2-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)C1CN1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-10(2,3)9(13)8-7-12(8)16(14,15)11(4,5)6/h8-9,13H,7H2,1-6H3 |
| InChIKey | PMCWIFRAFVKMDT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|