C13H23NO4 — CID 134963927
ethyl (2R)-2-[(1R,3R,8aR)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate (PubChem CID 134963927) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl (2R)-2-[(1R,3R,8aR)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2R)-2-[(1R,3R,8aR)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 134963927 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | ethyl (2R)-2-[(1R,3R,8aR)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@H](O)[C@H]1C[C@@H](OC)[C@H]2CCCCN21 |
| InChI | InChI=1S/C13H23NO4/c1-3-18-13(16)12(15)10-8-11(17-2)9-6-4-5-7-14(9)10/h9-12,15H,3-8H2,1-2H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | VTFQQCZLOYNEHY-DDHJBXDOSA-N |
| XLogP | 0.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |