C14H15NS — CID 134964037
(1S,2S)-2-thiophen-3-yl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 134964037) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is (1S,2S)-2-thiophen-3-yl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,2S)-2-thiophen-3-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 134964037 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (1S,2S)-2-thiophen-3-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1c2ccccc2CC[C@H]1c1ccsc1 |
| InChI | InChI=1S/C14H15NS/c15-14-12-4-2-1-3-10(12)5-6-13(14)11-7-8-16-9-11/h1-4,7-9,13-14H,5-6,15H2/t13-,14+/m0/s1 |
| InChIKey | FIIOOFNQBDVZSG-UONOGXRCSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |