C15H22O — CID 134964201
(1S)-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]trideca-7,10-diene (PubChem CID 134964201) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S)-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]trideca-7,10-diene.
| Compound Name | (1S)-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]trideca-7,10-diene |
|---|---|
| PubChem CID | 134964201 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S)-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]trideca-7,10-diene |
| SMILES | CC1(C)OC=C2CC=C[C@@]3(C)CCC1C2C3 |
| InChI | InChI=1S/C15H22O/c1-14(2)13-6-8-15(3)7-4-5-11(10-16-14)12(13)9-15/h4,7,10,12-13H,5-6,8-9H2,1-3H3/t12?,13?,15-/m0/s1 |
| InChIKey | SFKULGWGQNKSMA-PIMMBPRGSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|