About 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline
5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline (PubChem CID 134964303) has the molecular formula C16H13NS
and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline |
| PubChem CID | 134964303 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline |
| SMILES | C1=C(c2ccsc2)N2CCC=C2c2ccccc21 |
| InChI | InChI=1S/C16H13NS/c1-2-5-14-12(4-1)10-16(13-7-9-18-11-13)17-8-3-6-15(14)17/h1-2,4-7,9-11H,3,8H2 |
| InChIKey | MCBXJQGIKHIUTP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline?
The IUPAC name of 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline (CID 134964303) is 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline.
What is the SMILES notation for 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline?
The canonical SMILES for 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline is C1=C(c2ccsc2)N2CCC=C2c2ccccc21.
What is the InChIKey of 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline?
The InChIKey is MCBXJQGIKHIUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NS/c1-2-5-14-12(4-1)10-16(13-7-9-18-11-13)17-8-3-6-15(14)17/h1-2,4-7,9-11H,3,8H2.
What are the key properties of 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline?
5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline has a molecular weight of 251.35 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thiophen-3-yl-2,3-dihydropyrrolo[2,1-a]isoquinoline is sourced from PubChem (CID 134964303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).