C10H15ClO3 — CID 134964318
3-(4-chloro-3,6-dihydro-2H-pyran-6-yl)propyl acetate (PubChem CID 134964318) has the molecular formula C10H15ClO3 and a molecular weight of 218.68 g/mol. Its IUPAC name is 3-(4-chloro-3,6-dihydro-2H-pyran-6-yl)propyl acetate.
| Compound Name | 3-(4-chloro-3,6-dihydro-2H-pyran-6-yl)propyl acetate |
|---|---|
| PubChem CID | 134964318 |
| Molecular Formula | C10H15ClO3 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3-(4-chloro-3,6-dihydro-2H-pyran-6-yl)propyl acetate |
| SMILES | CC(=O)OCCCC1C=C(Cl)CCO1 |
| InChI | InChI=1S/C10H15ClO3/c1-8(12)13-5-2-3-10-7-9(11)4-6-14-10/h7,10H,2-6H2,1H3 |
| InChIKey | YRCRTQMLOUWMNG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|