C12H10F5NO2 — CID 134964387
(5S)-2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazolidine-5-carbaldehyde (PubChem CID 134964387) has the molecular formula C12H10F5NO2 and a molecular weight of 295.21 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazolidine-5-carbaldehyde.
| Compound Name | (5S)-2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazolidine-5-carbaldehyde |
|---|---|
| PubChem CID | 134964387 |
| Molecular Formula | C12H10F5NO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (5S)-2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazolidine-5-carbaldehyde |
| SMILES | CN1O[C@](C)(C=O)CC1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5NO2/c1-12(4-19)3-5(18(2)20-12)6-7(13)9(15)11(17)10(16)8(6)14/h4-5H,3H2,1-2H3/t5?,12-/m0/s1 |
| InChIKey | YVCNIAFBYORWQT-GFKGLTBGSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|