About (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid
(3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid (PubChem CID 134964498) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid.
Molecular Properties
| Compound Name | (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid |
| PubChem CID | 134964498 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid |
| SMILES | O=C(O)C[C@@H](C1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)5(4-7(13)14)6-2-1-3-12-6/h5-6,12H,1-4H2,(H,13,14)/t5-,6?/m0/s1 |
| InChIKey | LUGSXDZLMQJSGM-ZBHICJROSA-N |
| XLogP | 1.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid?
The IUPAC name of (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid (CID 134964498) is (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid.
What is the SMILES notation for (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid?
The canonical SMILES for (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid is O=C(O)C[C@@H](C1CCCN1)C(F)(F)F.
What is the InChIKey of (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid?
The InChIKey is LUGSXDZLMQJSGM-ZBHICJROSA-N. The full InChI is InChI=1S/C8H12F3NO2/c9-8(10,11)5(4-7(13)14)6-2-1-3-12-6/h5-6,12H,1-4H2,(H,13,14)/t5-,6?/m0/s1.
What are the key properties of (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid?
(3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid has a molecular weight of 211.18 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4,4-trifluoro-3-pyrrolidin-2-ylbutanoic acid is sourced from PubChem (CID 134964498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).