About [(E)-non-3-en-5-yn-2-yl] acetate
[(E)-non-3-en-5-yn-2-yl] acetate (PubChem CID 134964605) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is [(E)-non-3-en-5-yn-2-yl] acetate.
Molecular Properties
| Compound Name | [(E)-non-3-en-5-yn-2-yl] acetate |
| PubChem CID | 134964605 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | [(E)-non-3-en-5-yn-2-yl] acetate |
| SMILES | CCCC#C/C=C/C(C)OC(C)=O |
| InChI | InChI=1S/C11H16O2/c1-4-5-6-7-8-9-10(2)13-11(3)12/h8-10H,4-5H2,1-3H3/b9-8+ |
| InChIKey | OSGBFFHSILNKSE-CMDGGOBGSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-non-3-en-5-yn-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-non-3-en-5-yn-2-yl] acetate?
The IUPAC name of [(E)-non-3-en-5-yn-2-yl] acetate (CID 134964605) is [(E)-non-3-en-5-yn-2-yl] acetate.
What is the SMILES notation for [(E)-non-3-en-5-yn-2-yl] acetate?
The canonical SMILES for [(E)-non-3-en-5-yn-2-yl] acetate is CCCC#C/C=C/C(C)OC(C)=O.
What is the InChIKey of [(E)-non-3-en-5-yn-2-yl] acetate?
The InChIKey is OSGBFFHSILNKSE-CMDGGOBGSA-N. The full InChI is InChI=1S/C11H16O2/c1-4-5-6-7-8-9-10(2)13-11(3)12/h8-10H,4-5H2,1-3H3/b9-8+.
What are the key properties of [(E)-non-3-en-5-yn-2-yl] acetate?
[(E)-non-3-en-5-yn-2-yl] acetate has a molecular weight of 180.25 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-non-3-en-5-yn-2-yl] acetate is sourced from PubChem (CID 134964605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).