C15H32O2Si — CID 134964655
(4R,5E,6S)-6-methyl-5-(trimethylsilylmethylidene)decane-4,6-diol (PubChem CID 134964655) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (4R,5E,6S)-6-methyl-5-(trimethylsilylmethylidene)decane-4,6-diol.
| Compound Name | (4R,5E,6S)-6-methyl-5-(trimethylsilylmethylidene)decane-4,6-diol |
|---|---|
| PubChem CID | 134964655 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (4R,5E,6S)-6-methyl-5-(trimethylsilylmethylidene)decane-4,6-diol |
| SMILES | CCCC[C@](C)(O)/C(=C/[Si](C)(C)C)[C@H](O)CCC |
| InChI | InChI=1S/C15H32O2Si/c1-7-9-11-15(3,17)13(12-18(4,5)6)14(16)10-8-2/h12,14,16-17H,7-11H2,1-6H3/b13-12+/t14-,15+/m1/s1 |
| InChIKey | LKIASUFGTOQPGO-WCVFXIOZSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|