C14H30OSi2 — CID 134964794
(2E,5Z)-2-methyl-5,6-bis(trimethylsilyl)hepta-2,5-dien-1-ol (PubChem CID 134964794) has the molecular formula C14H30OSi2 and a molecular weight of 270.56 g/mol. Its IUPAC name is (2E,5Z)-2-methyl-5,6-bis(trimethylsilyl)hepta-2,5-dien-1-ol.
| Compound Name | (2E,5Z)-2-methyl-5,6-bis(trimethylsilyl)hepta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 134964794 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2E,5Z)-2-methyl-5,6-bis(trimethylsilyl)hepta-2,5-dien-1-ol |
| SMILES | C/C(=C(\C/C=C(\C)CO)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi2/c1-12(11-15)9-10-14(17(6,7)8)13(2)16(3,4)5/h9,15H,10-11H2,1-8H3/b12-9+,14-13- |
| InChIKey | WJRMQGCTEHQTOV-KQVVTMDQSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|