C10H18O2 — CID 134964831
[(1R,2E,3S)-2-ethylidene-3-(hydroxymethyl)-3-methylcyclopentyl]methanol (PubChem CID 134964831) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is [(1R,2E,3S)-2-ethylidene-3-(hydroxymethyl)-3-methylcyclopentyl]methanol.
| Compound Name | [(1R,2E,3S)-2-ethylidene-3-(hydroxymethyl)-3-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 134964831 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | [(1R,2E,3S)-2-ethylidene-3-(hydroxymethyl)-3-methylcyclopentyl]methanol |
| SMILES | C/C=C1\[C@H](CO)CC[C@]1(C)CO |
| InChI | InChI=1S/C10H18O2/c1-3-9-8(6-11)4-5-10(9,2)7-12/h3,8,11-12H,4-7H2,1-2H3/b9-3+/t8-,10+/m0/s1 |
| InChIKey | PBQIMDQZXSJMRW-QYWHHAKLSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|