C14H16O2 — CID 134964852
(2S,3'R)-3'-propylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 134964852) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S,3'R)-3'-propylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
| Compound Name | (2S,3'R)-3'-propylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 134964852 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2S,3'R)-3'-propylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | CCC[C@H]1O[C@@]12CCc1ccccc1C2=O |
| InChI | InChI=1S/C14H16O2/c1-2-5-12-14(16-12)9-8-10-6-3-4-7-11(10)13(14)15/h3-4,6-7,12H,2,5,8-9H2,1H3/t12-,14+/m1/s1 |
| InChIKey | YMQGZSGYHKKAAO-OCCSQVGLSA-N |
| XLogP | 2.75 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|