About 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one
3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one (PubChem CID 134965005) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one.
Molecular Properties
| Compound Name | 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
| PubChem CID | 134965005 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
| SMILES | C=CCC1CC2CC3C=CC(=O)C2(C1)O3 |
| InChI | InChI=1S/C13H16O2/c1-2-3-9-6-10-7-11-4-5-12(14)13(10,8-9)15-11/h2,4-5,9-11H,1,3,6-8H2 |
| InChIKey | UAVBSWKUJYOGSC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one?
The IUPAC name of 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one (CID 134965005) is 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one.
What is the SMILES notation for 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one?
The canonical SMILES for 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one is C=CCC1CC2CC3C=CC(=O)C2(C1)O3.
What is the InChIKey of 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one?
The InChIKey is UAVBSWKUJYOGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-3-9-6-10-7-11-4-5-12(14)13(10,8-9)15-11/h2,4-5,9-11H,1,3,6-8H2.
What are the key properties of 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one?
3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one has a molecular weight of 204.27 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one is sourced from PubChem (CID 134965005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).