C13H15NO3S — CID 134965061
methyl (1R,3S,3aR,6aS)-6-oxo-1-thiophen-2-yl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 134965061) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-6-oxo-1-thiophen-2-yl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-6-oxo-1-thiophen-2-yl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134965061 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-6-oxo-1-thiophen-2-yl-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2cccs2)[C@H]2C(=O)CC[C@H]21 |
| InChI | InChI=1S/C13H15NO3S/c1-17-13(16)11-7-4-5-8(15)10(7)12(14-11)9-3-2-6-18-9/h2-3,6-7,10-12,14H,4-5H2,1H3/t7-,10-,11+,12+/m1/s1 |
| InChIKey | CUPLJHOVFLAIBR-HNXYORABSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |