About 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol
2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol (PubChem CID 134965090) has the molecular formula C9H7BrF3NO3
and a molecular weight of 314.06 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol |
| PubChem CID | 134965090 |
| Molecular Formula | C9H7BrF3NO3 |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol |
| SMILES | O=[N+]([O-])CC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H7BrF3NO3/c10-7-3-1-6(2-4-7)8(15,5-14(16)17)9(11,12)13/h1-4,15H,5H2 |
| InChIKey | FEWZNHQLJIDVEB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol?
The IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol (CID 134965090) is 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol.
What is the SMILES notation for 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol?
The canonical SMILES for 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol is O=[N+]([O-])CC(O)(c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol?
The InChIKey is FEWZNHQLJIDVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF3NO3/c10-7-3-1-6(2-4-7)8(15,5-14(16)17)9(11,12)13/h1-4,15H,5H2.
What are the key properties of 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol?
2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol has a molecular weight of 314.06 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,1,1-trifluoro-3-nitropropan-2-ol is sourced from PubChem (CID 134965090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).