C16H26O3 — CID 134965154
(2R)-2-ethoxy-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one (PubChem CID 134965154) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R)-2-ethoxy-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one.
| Compound Name | (2R)-2-ethoxy-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one |
|---|---|
| PubChem CID | 134965154 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2R)-2-ethoxy-6,6a-dimethyl-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-one |
| SMILES | CCO[C@H]1CC23CC(=O)CCC2(C)C(C)CCC3O1 |
| InChI | InChI=1S/C16H26O3/c1-4-18-14-10-16-9-12(17)7-8-15(16,3)11(2)5-6-13(16)19-14/h11,13-14H,4-10H2,1-3H3/t11?,13?,14-,15?,16?/m1/s1 |
| InChIKey | IUHZSWXYLDNKJJ-RCDWCFMMSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |