About methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate
methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 134965158) has the molecular formula C11H12BrNO3
and a molecular weight of 286.12 g/mol. Its IUPAC name is methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 134965158 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](O)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H12BrNO3/c1-16-11(15)13-6-9(14)5-7-4-8(12)2-3-10(7)13/h2-4,9,14H,5-6H2,1H3/t9-/m0/s1 |
| InChIKey | IUNOHSPSQRQRSU-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate (CID 134965158) is methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate is COC(=O)N1C[C@@H](O)Cc2cc(Br)ccc21.
What is the InChIKey of methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is IUNOHSPSQRQRSU-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12BrNO3/c1-16-11(15)13-6-9(14)5-7-4-8(12)2-3-10(7)13/h2-4,9,14H,5-6H2,1H3/t9-/m0/s1.
What are the key properties of methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate?
methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 286.12 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-6-bromo-3-hydroxy-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 134965158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).