About 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde
6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde (PubChem CID 134965172) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde |
| PubChem CID | 134965172 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde |
| SMILES | CN(C)c1ccc2cc3c(c(C=O)c2c1)CCC3 |
| InChI | InChI=1S/C16H17NO/c1-17(2)13-7-6-12-8-11-4-3-5-14(11)16(10-18)15(12)9-13/h6-10H,3-5H2,1-2H3 |
| InChIKey | ZTUJWILLRNHVSV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde?
The IUPAC name of 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde (CID 134965172) is 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde.
What is the SMILES notation for 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde?
The canonical SMILES for 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde is CN(C)c1ccc2cc3c(c(C=O)c2c1)CCC3.
What is the InChIKey of 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde?
The InChIKey is ZTUJWILLRNHVSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-17(2)13-7-6-12-8-11-4-3-5-14(11)16(10-18)15(12)9-13/h6-10H,3-5H2,1-2H3.
What are the key properties of 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde?
6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde has a molecular weight of 239.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2,3-dihydro-1H-cyclopenta[b]naphthalene-4-carbaldehyde is sourced from PubChem (CID 134965172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).