About (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one
(9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 134965188) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one.
Molecular Properties
| Compound Name | (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one |
| PubChem CID | 134965188 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C1=C\CCCCCCC(=O)OC(C)C1 |
| InChI | InChI=1S/C13H22O2/c1-11-8-6-4-3-5-7-9-13(14)15-12(2)10-11/h8,12H,3-7,9-10H2,1-2H3/b11-8+ |
| InChIKey | WKLNNIXXHQDDEW-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one?
The IUPAC name of (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one (CID 134965188) is (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one.
What is the SMILES notation for (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one?
The canonical SMILES for (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one is C/C1=C\CCCCCCC(=O)OC(C)C1.
What is the InChIKey of (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one?
The InChIKey is WKLNNIXXHQDDEW-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H22O2/c1-11-8-6-4-3-5-7-9-13(14)15-12(2)10-11/h8,12H,3-7,9-10H2,1-2H3/b11-8+.
What are the key properties of (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one?
(9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one has a molecular weight of 210.32 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-10,12-dimethyl-1-oxacyclododec-9-en-2-one is sourced from PubChem (CID 134965188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).