About (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium
(6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium (PubChem CID 134965446) has the molecular formula C6H3ClN2YZn-2
and a molecular weight of 292.85 g/mol. Its IUPAC name is (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium.
Molecular Properties
| Compound Name | (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium |
| PubChem CID | 134965446 |
| Molecular Formula | C6H3ClN2YZn-2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 290.83 |
| IUPAC Name | (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium |
| SMILES | Cl[Zn+].[N-]=C1[C-]=CC=CC1=[N-].[Y] |
| InChI | InChI=1S/C6H3N2.ClH.Y.Zn/c7-5-3-1-2-4-6(5)8;;;/h1-3H;1H;;/q-3;;;+2/p-1 |
| InChIKey | CNZZLKHJPBZVHE-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium?
The IUPAC name of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium (CID 134965446) is (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium.
What is the SMILES notation for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium?
The canonical SMILES for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium is Cl[Zn+].[N-]=C1[C-]=CC=CC1=[N-].[Y].
What is the InChIKey of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium?
The InChIKey is CNZZLKHJPBZVHE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3N2.ClH.Y.Zn/c7-5-3-1-2-4-6(5)8;;;/h1-3H;1H;;/q-3;;;+2/p-1.
What are the key properties of (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium?
(6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium has a molecular weight of 292.85 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-azanidylidenecyclohexa-2,4-dien-1-ylidene)azanide;chlorozinc(1+);yttrium is sourced from PubChem (CID 134965446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).