C11H14F2O3 — CID 134965497
ethyl (1R,2R,3R,4R)-3-(difluoromethyl)-5-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134965497) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4R)-3-(difluoromethyl)-5-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4R)-3-(difluoromethyl)-5-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134965497 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl (1R,2R,3R,4R)-3-(difluoromethyl)-5-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(F)F)[C@H]2O[C@@H]1C=C2C |
| InChI | InChI=1S/C11H14F2O3/c1-3-15-11(14)7-6-4-5(2)9(16-6)8(7)10(12)13/h4,6-10H,3H2,1-2H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | HFPLRZVKADXONN-XAVMHZPKSA-N |
| XLogP | 1.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|