C11H14F2O2 — CID 134965528
ethyl (1R,2S,3S,4S)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134965528) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is ethyl (1R,2S,3S,4S)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2S,3S,4S)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134965528 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethyl (1R,2S,3S,4S)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(F)F)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H14F2O2/c1-2-15-11(14)9-7-4-3-6(5-7)8(9)10(12)13/h3-4,6-10H,2,5H2,1H3/t6-,7+,8+,9+/m1/s1 |
| InChIKey | MHJLTVRBARCETO-XGEHTFHBSA-N |
| XLogP | 2.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|